C23H26N6O2 — CID 73280278
7,9-dimethyl-1-[(4-methylphenyl)methyl]-3-phenyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73280278) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 7,9-dimethyl-1-[(4-methylphenyl)methyl]-3-phenyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 7,9-dimethyl-1-[(4-methylphenyl)methyl]-3-phenyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73280278 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 7,9-dimethyl-1-[(4-methylphenyl)methyl]-3-phenyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | Cc1ccc(CN2N=C(c3ccccc3)CN3C4C(=O)N(C)C(=O)N(C)C4NC23)cc1 |
| InChI | InChI=1S/C23H26N6O2/c1-15-9-11-16(12-10-15)13-29-22-24-20-19(21(30)27(3)23(31)26(20)2)28(22)14-18(25-29)17-7-5-4-6-8-17/h4-12,19-20,22,24H,13-14H2,1-3H3 |
| InChIKey | ZARFATFLMCZNIX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |