C19H25ClN6O2 — CID 73448758
1-[(3-chlorophenyl)methyl]-3,9-dimethyl-7-propyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73448758) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3,9-dimethyl-7-propyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3,9-dimethyl-7-propyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73448758 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3,9-dimethyl-7-propyl-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CCCN1C(=O)C2C(NC3N(Cc4cccc(Cl)c4)N=C(C)CN23)N(C)C1=O |
| InChI | InChI=1S/C19H25ClN6O2/c1-4-8-24-17(27)15-16(23(3)19(24)28)21-18-25(15)10-12(2)22-26(18)11-13-6-5-7-14(20)9-13/h5-7,9,15-16,18,21H,4,8,10-11H2,1-3H3 |
| InChIKey | SWTXYOCBCSJHIG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |