C19H22ClFN6O4 — CID 73259091
methyl 2-[7-[(2-chloro-6-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetate (PubChem CID 73259091) has the molecular formula C19H22ClFN6O4 and a molecular weight of 452.87 g/mol. Its IUPAC name is methyl 2-[7-[(2-chloro-6-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetate.
| Compound Name | methyl 2-[7-[(2-chloro-6-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetate |
|---|---|
| PubChem CID | 73259091 |
| Molecular Formula | C19H22ClFN6O4 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl 2-[7-[(2-chloro-6-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetate |
| SMILES | COC(=O)CN1N=C(C)CN2C3C(=O)N(Cc4c(F)cccc4Cl)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C19H22ClFN6O4/c1-10-7-25-15-16(22-18(25)27(23-10)9-14(28)31-3)24(2)19(30)26(17(15)29)8-11-12(20)5-4-6-13(11)21/h4-6,15-16,18,22H,7-9H2,1-3H3 |
| InChIKey | KXDPXFSBFRJRMA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |