C18H22FN7O3 — CID 73328024
2-[7-[(2-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetamide (PubChem CID 73328024) has the molecular formula C18H22FN7O3 and a molecular weight of 403.42 g/mol. Its IUPAC name is 2-[7-[(2-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetamide.
| Compound Name | 2-[7-[(2-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetamide |
|---|---|
| PubChem CID | 73328024 |
| Molecular Formula | C18H22FN7O3 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[7-[(2-fluorophenyl)methyl]-3,9-dimethyl-6,8-dioxo-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetamide |
| SMILES | CC1=NN(CC(N)=O)C2NC3C(C(=O)N(Cc4ccccc4F)C(=O)N3C)N2C1 |
| InChI | InChI=1S/C18H22FN7O3/c1-10-7-24-14-15(21-17(24)26(22-10)9-13(20)27)23(2)18(29)25(16(14)28)8-11-5-3-4-6-12(11)19/h3-6,14-15,17,21H,7-9H2,1-2H3,(H2,20,27) |
| InChIKey | TZWHTWBTCNCUBP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |