C23H26FN5O3 — CID 78305178
3-[(2-fluorophenyl)methyl]-9-(2-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 78305178) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-9-(2-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 3-[(2-fluorophenyl)methyl]-9-(2-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78305178 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-9-(2-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | COc1ccccc1N1CCCN2C3C(=O)N(Cc4ccccc4F)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C23H26FN5O3/c1-26-20-19(21(30)29(23(26)31)14-15-8-3-4-9-16(15)24)28-13-7-12-27(22(28)25-20)17-10-5-6-11-18(17)32-2/h3-6,8-11,19-20,22,25H,7,12-14H2,1-2H3 |
| InChIKey | DZDANVCMPCISQT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |