C23H25Cl2N5O3 — CID 78315614
3-[(2,4-dichlorophenyl)methyl]-9-(3-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 78315614) has the molecular formula C23H25Cl2N5O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-9-(3-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-9-(3-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78315614 |
| Molecular Formula | C23H25Cl2N5O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-9-(3-methoxyphenyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | COc1cccc(N2CCCN3C4C(=O)N(Cc5ccc(Cl)cc5Cl)C(=O)N(C)C4NC23)c1 |
| InChI | InChI=1S/C23H25Cl2N5O3/c1-27-20-19(21(31)30(23(27)32)13-14-7-8-15(24)11-18(14)25)29-10-4-9-28(22(29)26-20)16-5-3-6-17(12-16)33-2/h3,5-8,11-12,19-20,22,26H,4,9-10,13H2,1-2H3 |
| InChIKey | DJMPWNLXOCDNEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |