C19H26ClN5O4 — CID 78508107
9-(3-chloro-4-methoxyphenyl)-3-(2-methoxyethyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 78508107) has the molecular formula C19H26ClN5O4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 9-(3-chloro-4-methoxyphenyl)-3-(2-methoxyethyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-(3-chloro-4-methoxyphenyl)-3-(2-methoxyethyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78508107 |
| Molecular Formula | C19H26ClN5O4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 9-(3-chloro-4-methoxyphenyl)-3-(2-methoxyethyl)-1-methyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | COCCN1C(=O)C2C(NC3N(c4ccc(OC)c(Cl)c4)CCCN23)N(C)C1=O |
| InChI | InChI=1S/C19H26ClN5O4/c1-22-16-15(17(26)25(19(22)27)9-10-28-2)24-8-4-7-23(18(24)21-16)12-5-6-14(29-3)13(20)11-12/h5-6,11,15-16,18,21H,4,7-10H2,1-3H3 |
| InChIKey | PUKFVXYRNMVYEJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|