C20H27N5O6 — CID 73328587
methyl 2-[9-(2,5-dimethoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate (PubChem CID 73328587) has the molecular formula C20H27N5O6 and a molecular weight of 433.47 g/mol. Its IUPAC name is methyl 2-[9-(2,5-dimethoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate.
| Compound Name | methyl 2-[9-(2,5-dimethoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
|---|---|
| PubChem CID | 73328587 |
| Molecular Formula | C20H27N5O6 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | methyl 2-[9-(2,5-dimethoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2C(NC3N(c4cc(OC)ccc4OC)CCCN23)N(C)C1=O |
| InChI | InChI=1S/C20H27N5O6/c1-22-17-16(18(27)25(20(22)28)11-15(26)31-4)24-9-5-8-23(19(24)21-17)13-10-12(29-2)6-7-14(13)30-3/h6-7,10,16-17,19,21H,5,8-9,11H2,1-4H3 |
| InChIKey | HTYJRKSUIGAFTO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |