C23H35N5O3 — CID 73328603
9-(2-methoxy-5-methylphenyl)-1,7-dimethyl-3-pentyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 73328603) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 9-(2-methoxy-5-methylphenyl)-1,7-dimethyl-3-pentyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-(2-methoxy-5-methylphenyl)-1,7-dimethyl-3-pentyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73328603 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 9-(2-methoxy-5-methylphenyl)-1,7-dimethyl-3-pentyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CCCCCN1C(=O)C2C(NC3N(c4cc(C)ccc4OC)CC(C)CN23)N(C)C1=O |
| InChI | InChI=1S/C23H35N5O3/c1-6-7-8-11-26-21(29)19-20(25(4)23(26)30)24-22-27(13-16(3)14-28(19)22)17-12-15(2)9-10-18(17)31-5/h9-10,12,16,19-20,22,24H,6-8,11,13-14H2,1-5H3 |
| InChIKey | VAWXXYFUMOQZPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|