C21H31N5O5 — CID 73328599
9-(2,5-dimethoxyphenyl)-3-(3-hydroxypropyl)-1,7-dimethyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 73328599) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is 9-(2,5-dimethoxyphenyl)-3-(3-hydroxypropyl)-1,7-dimethyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-(2,5-dimethoxyphenyl)-3-(3-hydroxypropyl)-1,7-dimethyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73328599 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 9-(2,5-dimethoxyphenyl)-3-(3-hydroxypropyl)-1,7-dimethyl-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | COc1ccc(OC)c(N2CC(C)CN3C4C(=O)N(CCCO)C(=O)N(C)C4NC23)c1 |
| InChI | InChI=1S/C21H31N5O5/c1-13-11-25(15-10-14(30-3)6-7-16(15)31-4)20-22-18-17(26(20)12-13)19(28)24(8-5-9-27)21(29)23(18)2/h6-7,10,13,17-18,20,22,27H,5,8-9,11-12H2,1-4H3 |
| InChIKey | VCZACYCJJYQEOQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |