C25H29N5O2 — CID 156593073
1-methyl-9-(2-methylphenyl)-3-[(E)-3-phenylprop-2-enyl]-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 156593073) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-methyl-9-(2-methylphenyl)-3-[(E)-3-phenylprop-2-enyl]-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-9-(2-methylphenyl)-3-[(E)-3-phenylprop-2-enyl]-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156593073 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-methyl-9-(2-methylphenyl)-3-[(E)-3-phenylprop-2-enyl]-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | Cc1ccccc1N1CCCN2C3C(=O)N(C/C=C/c4ccccc4)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C25H29N5O2/c1-18-10-6-7-14-20(18)28-16-9-17-29-21-22(26-24(28)29)27(2)25(32)30(23(21)31)15-8-13-19-11-4-3-5-12-19/h3-8,10-14,21-22,24,26H,9,15-17H2,1-2H3/b13-8+ |
| InChIKey | QVDIQFUJMFKJBQ-MDWZMJQESA-N |
| XLogP | 2.70 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |