C20H25ClN6O2 — CID 73280262
7-[(4-chlorophenyl)methyl]-3,9-dimethyl-1-(2-methylprop-2-enyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73280262) has the molecular formula C20H25ClN6O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3,9-dimethyl-1-(2-methylprop-2-enyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3,9-dimethyl-1-(2-methylprop-2-enyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73280262 |
| Molecular Formula | C20H25ClN6O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3,9-dimethyl-1-(2-methylprop-2-enyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | C=C(C)CN1N=C(C)CN2C3C(=O)N(Cc4ccc(Cl)cc4)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C20H25ClN6O2/c1-12(2)9-27-19-22-17-16(25(19)10-13(3)23-27)18(28)26(20(29)24(17)4)11-14-5-7-15(21)8-6-14/h5-8,16-17,19,22H,1,9-11H2,2-4H3 |
| InChIKey | UNMBMGJLGNYIMY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|