C21H28N6O3 — CID 73280479
7-[(2,5-dimethylphenyl)methyl]-3,9-dimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73280479) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 7-[(2,5-dimethylphenyl)methyl]-3,9-dimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 7-[(2,5-dimethylphenyl)methyl]-3,9-dimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73280479 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 7-[(2,5-dimethylphenyl)methyl]-3,9-dimethyl-1-(2-oxopropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC(=O)CN1N=C(C)CN2C3C(=O)N(Cc4cc(C)ccc4C)C(=O)N(C)C3NC12 |
| InChI | InChI=1S/C21H28N6O3/c1-12-6-7-13(2)16(8-12)11-26-19(29)17-18(24(5)21(26)30)22-20-25(17)9-14(3)23-27(20)10-15(4)28/h6-8,17-18,20,22H,9-11H2,1-5H3 |
| InChIKey | LXNTXVFFQVFPLZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |