C23H29N5O4 — CID 73284396
ethyl 3-[6-(3,5-dimethylphenyl)-4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]propanoate (PubChem CID 73284396) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is ethyl 3-[6-(3,5-dimethylphenyl)-4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]propanoate.
| Compound Name | ethyl 3-[6-(3,5-dimethylphenyl)-4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 73284396 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | ethyl 3-[6-(3,5-dimethylphenyl)-4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)C2C(N=C3N(c4cc(C)cc(C)c4)C(C)=C(C)N32)N(C)C1=O |
| InChI | InChI=1S/C23H29N5O4/c1-7-32-18(29)8-9-26-21(30)19-20(25(6)23(26)31)24-22-27(15(4)16(5)28(19)22)17-11-13(2)10-14(3)12-17/h10-12,19-20H,7-9H2,1-6H3 |
| InChIKey | WHAIEAJVAGWXDD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |