C20H22F3N5O3S — CID 73291808
2-[6-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]-3-pyridinyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 73291808) has the molecular formula C20H22F3N5O3S and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-[6-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]-3-pyridinyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[6-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]-3-pyridinyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 73291808 |
| Molecular Formula | C20H22F3N5O3S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-[6-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]-3-pyridinyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc(C(C)(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H22F3N5O3S/c1-3-4-15-13-27(32(30,31)16-6-7-17(24)25-12-16)9-10-28(15)18-8-5-14(11-26-18)19(2,29)20(21,22)23/h5-8,11-12,15,29H,9-10,13H2,1-2H3,(H2,24,25)/t15-,19?/m0/s1 |
| InChIKey | MOLOPUYCOFPVOR-FUKCDUGKSA-N |
| XLogP | 1.73 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|