C11H13NO2 — CID 73294129
2-butyl-6-oxidofuro[2,3-c]pyridin-6-ium (PubChem CID 73294129) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-butyl-6-oxidofuro[2,3-c]pyridin-6-ium.
| Compound Name | 2-butyl-6-oxidofuro[2,3-c]pyridin-6-ium |
|---|---|
| PubChem CID | 73294129 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-butyl-6-oxidofuro[2,3-c]pyridin-6-ium |
| SMILES | CCCCc1cc2cc[n+]([O-])cc2o1 |
| InChI | InChI=1S/C11H13NO2/c1-2-3-4-10-7-9-5-6-12(13)8-11(9)14-10/h5-8H,2-4H2,1H3 |
| InChIKey | FXOVYSQNFJABBF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|