About pyridin-1-ium-1-sulfonic acid chloride
pyridin-1-ium-1-sulfonic acid chloride (PubChem CID 73294198) has the molecular formula C5H6ClNO3S
and a molecular weight of 195.63 g/mol. Its IUPAC name is pyridin-1-ium-1-sulfonic acid chloride.
Molecular Properties
| Compound Name | pyridin-1-ium-1-sulfonic acid chloride |
| PubChem CID | 73294198 |
| Molecular Formula | C5H6ClNO3S |
| Molecular Weight | 195.63 g/mol |
| Exact Mass | 194.98 |
| IUPAC Name | pyridin-1-ium-1-sulfonic acid chloride |
| SMILES | O=S(=O)(O)[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C5H5NO3S.ClH/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H;1H |
| InChIKey | DREZXSMSKOTBPQ-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.63 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-sulfonic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-sulfonic acid chloride?
The IUPAC name of pyridin-1-ium-1-sulfonic acid chloride (CID 73294198) is pyridin-1-ium-1-sulfonic acid chloride.
What is the SMILES notation for pyridin-1-ium-1-sulfonic acid chloride?
The canonical SMILES for pyridin-1-ium-1-sulfonic acid chloride is O=S(=O)(O)[n+]1ccccc1.[Cl-].
What is the InChIKey of pyridin-1-ium-1-sulfonic acid chloride?
The InChIKey is DREZXSMSKOTBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S.ClH/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H;1H.
What are the key properties of pyridin-1-ium-1-sulfonic acid chloride?
pyridin-1-ium-1-sulfonic acid chloride has a molecular weight of 195.63 g/mol, XLogP of -3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-sulfonic acid chloride is sourced from PubChem (CID 73294198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).