C23H22F3N3O4 — CID 73295316
2-(4-hydroxybutoxy)-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid (PubChem CID 73295316) has the molecular formula C23H22F3N3O4 and a molecular weight of 461.44 g/mol. Its IUPAC name is 2-(4-hydroxybutoxy)-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid.
| Compound Name | 2-(4-hydroxybutoxy)-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 73295316 |
| Molecular Formula | C23H22F3N3O4 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-(4-hydroxybutoxy)-5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzoic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2ccc(OCCCCO)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H22F3N3O4/c1-14-10-16(12-17(11-14)28-22-27-7-6-20(29-22)23(24,25)26)15-4-5-19(18(13-15)21(31)32)33-9-3-2-8-30/h4-7,10-13,30H,2-3,8-9H2,1H3,(H,31,32)(H,27,28,29) |
| InChIKey | ITOCOOIZIVCUSP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|