C18H14F4N2O — CID 73309421
2-(2-fluorophenyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 73309421) has the molecular formula C18H14F4N2O and a molecular weight of 350.32 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 73309421 |
| Molecular Formula | C18H14F4N2O |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(C(F)(F)F)cc1)C1CC1c1ccccc1F |
| InChI | InChI=1S/C18H14F4N2O/c19-16-4-2-1-3-13(16)14-9-15(14)17(25)24-23-10-11-5-7-12(8-6-11)18(20,21)22/h1-8,10,14-15H,9H2,(H,24,25) |
| InChIKey | AENUPDCCHVBZCQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|