C21H25NO6 — CID 7331932
3-O-ethyl 6-O-methyl (4R,4aS,6R,7R)-2,7-dimethyl-4-(5-methylfuran-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate (PubChem CID 7331932) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4R,4aS,6R,7R)-2,7-dimethyl-4-(5-methylfuran-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4R,4aS,6R,7R)-2,7-dimethyl-4-(5-methylfuran-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 7331932 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4R,4aS,6R,7R)-2,7-dimethyl-4-(5-methylfuran-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2C[C@@H](C)[C@@H](C(=O)OC)C(=O)[C@H]2[C@H]1c1ccc(C)o1 |
| InChI | InChI=1S/C21H25NO6/c1-6-27-21(25)16-12(4)22-13-9-10(2)15(20(24)26-5)19(23)17(13)18(16)14-8-7-11(3)28-14/h7-8,10,15,17-18H,6,9H2,1-5H3/t10-,15-,17-,18+/m1/s1 |
| InChIKey | PWPMQUIRTXEOHC-ONUGHKICSA-N |
| XLogP | 2.98 |
| TPSA | 95.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|