C23H26FNO5 — CID 7426586
diethyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate (PubChem CID 7426586) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is diethyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 7426586 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | diethyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2C[C@@H](C)[C@H](C(=O)OCC)C(=O)C2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C23H26FNO5/c1-5-29-22(27)17-12(3)10-16-20(21(17)26)19(14-8-7-9-15(24)11-14)18(13(4)25-16)23(28)30-6-2/h7-9,11-12,17,19-20H,5-6,10H2,1-4H3/t12-,17+,19-,20?/m1/s1 |
| InChIKey | FCERRQWPQWZEEE-PSYOCLCLSA-N |
| XLogP | 3.61 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|