C28H31NO6S — CID 7308153
diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-methylthiophen-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate (PubChem CID 7308153) has the molecular formula C28H31NO6S and a molecular weight of 509.62 g/mol. Its IUPAC name is diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-methylthiophen-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-methylthiophen-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 7308153 |
| Molecular Formula | C28H31NO6S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-methylthiophen-2-yl)-5-oxo-4a,6,7,8-tetrahydro-4H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2CC(c3cccc(OC)c3)[C@H](C(=O)OCC)C(=O)C2[C@@H]1c1sccc1C |
| InChI | InChI=1S/C28H31NO6S/c1-6-34-27(31)21-16(4)29-20-14-19(17-9-8-10-18(13-17)33-5)22(28(32)35-7-2)25(30)23(20)24(21)26-15(3)11-12-36-26/h8-13,19,22-24H,6-7,14H2,1-5H3/t19?,22-,23?,24+/m0/s1 |
| InChIKey | KOMLLLBPWRYRAM-DZXJHWIPSA-N |
| XLogP | 4.99 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|