C30H33NO7 — CID 6548215
diethyl (4R,6R,7S)-4,7-bis(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6548215) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is diethyl (4R,6R,7S)-4,7-bis(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6R,7S)-4,7-bis(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6548215 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | diethyl (4R,6R,7S)-4,7-bis(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OCC)[C@@H](c3cccc(OC)c3)C2)[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C30H33NO7/c1-6-37-29(33)24-17(3)31-23-16-22(18-10-8-12-20(14-18)35-4)26(30(34)38-7-2)28(32)27(23)25(24)19-11-9-13-21(15-19)36-5/h8-15,22,25-26,31H,6-7,16H2,1-5H3/t22-,25+,26-/m1/s1 |
| InChIKey | SBRDVWVGTPALPR-ZSQFBXSQSA-N |
| XLogP | 4.42 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|