C31H35NO8 — CID 51433426
diethyl (4S,6S,7S)-4-(3,4-dimethoxyphenyl)-7-(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51433426) has the molecular formula C31H35NO8 and a molecular weight of 549.62 g/mol. Its IUPAC name is diethyl (4S,6S,7S)-4-(3,4-dimethoxyphenyl)-7-(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7S)-4-(3,4-dimethoxyphenyl)-7-(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51433426 |
| Molecular Formula | C31H35NO8 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | diethyl (4S,6S,7S)-4-(3,4-dimethoxyphenyl)-7-(3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OCC)[C@@H](c3cccc(OC)c3)C2)[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H35NO8/c1-7-39-30(34)25-17(3)32-22-16-21(18-10-9-11-20(14-18)36-4)27(31(35)40-8-2)29(33)28(22)26(25)19-12-13-23(37-5)24(15-19)38-6/h9-15,21,26-27,32H,7-8,16H2,1-6H3/t21-,26-,27+/m1/s1 |
| InChIKey | SKMOOCZTDHJBDJ-ZFWHIUCFSA-N |
| XLogP | 4.43 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|