C35H35NO7 — CID 98607546
diethyl (4R,6R,7R)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 98607546) has the molecular formula C35H35NO7 and a molecular weight of 581.67 g/mol. Its IUPAC name is diethyl (4R,6R,7R)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4R,6R,7R)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98607546 |
| Molecular Formula | C35H35NO7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | diethyl (4R,6R,7R)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OCC)[C@H](c3ccc(OC)cc3)C2)[C@H]1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C35H35NO7/c1-5-41-34(38)29-21(3)36-28-20-27(22-15-17-24(40-4)18-16-22)31(35(39)42-6-2)33(37)32(28)30(29)23-11-10-14-26(19-23)43-25-12-8-7-9-13-25/h7-19,27,30-31,36H,5-6,20H2,1-4H3/t27-,30-,31+/m0/s1 |
| InChIKey | CIFFIGAFEKNHJI-FKCXQASGSA-N |
| XLogP | 6.20 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|