C29H30N2O8 — CID 94862098
diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 94862098) has the molecular formula C29H30N2O8 and a molecular weight of 534.57 g/mol. Its IUPAC name is diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 94862098 |
| Molecular Formula | C29H30N2O8 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | diethyl (4S,6S,7R)-7-(3-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OCC)[C@H](c3cccc(OC)c3)C2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H30N2O8/c1-5-38-28(33)23-16(3)30-22-15-21(17-9-8-12-20(14-17)37-4)25(29(34)39-6-2)27(32)26(22)24(23)18-10-7-11-19(13-18)31(35)36/h7-14,21,24-25,30H,5-6,15H2,1-4H3/t21-,24+,25-/m0/s1 |
| InChIKey | WVETUUQCJQRRQS-GPUOULLFSA-N |
| XLogP | 4.32 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|