C29H35N4O5+ — CID 73327009
3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[(2-methoxyphenyl)methyl]propanamide (PubChem CID 73327009) has the molecular formula C29H35N4O5+ and a molecular weight of 519.62 g/mol. Its IUPAC name is 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[(2-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[(2-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 73327009 |
| Molecular Formula | C29H35N4O5+ |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[(2-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccccc1CNC(=O)CCN1C(=O)C2C=CC=CC2=[N+](CC(=O)NCCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C29H34N4O5/c1-38-25-14-8-5-11-22(25)19-31-26(34)16-18-32-28(36)23-12-6-7-13-24(23)33(29(32)37)20-27(35)30-17-15-21-9-3-2-4-10-21/h5-9,11-14,23H,2-4,10,15-20H2,1H3,(H-,30,31,34,35)/p+1 |
| InChIKey | RPIMOIVERHTFPR-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|