C31H39N4O6+ — CID 75185626
3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 75185626) has the molecular formula C31H39N4O6+ and a molecular weight of 563.68 g/mol. Its IUPAC name is 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 75185626 |
| Molecular Formula | C31H39N4O6+ |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 3-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCN2C(=O)C3C=CC=CC3=[N+](CC(=O)NCCC3=CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C31H38N4O6/c1-40-26-13-12-23(20-27(26)41-2)15-18-32-28(36)16-19-34-30(38)24-10-6-7-11-25(24)35(31(34)39)21-29(37)33-17-14-22-8-4-3-5-9-22/h6-8,10-13,20,24H,3-5,9,14-19,21H2,1-2H3,(H-,32,33,36,37)/p+1 |
| InChIKey | KKHWESOXSASLGL-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|