C21H21N3O4S — CID 73328086
2-phenoxyethyl 2-[(5-cyano-4-oxo-6-phenyl-1,3-diazinan-2-yl)sulfanyl]acetate (PubChem CID 73328086) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[(5-cyano-4-oxo-6-phenyl-1,3-diazinan-2-yl)sulfanyl]acetate.
| Compound Name | 2-phenoxyethyl 2-[(5-cyano-4-oxo-6-phenyl-1,3-diazinan-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 73328086 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-phenoxyethyl 2-[(5-cyano-4-oxo-6-phenyl-1,3-diazinan-2-yl)sulfanyl]acetate |
| SMILES | N#CC1C(=O)NC(SCC(=O)OCCOc2ccccc2)NC1c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4S/c22-13-17-19(15-7-3-1-4-8-15)23-21(24-20(17)26)29-14-18(25)28-12-11-27-16-9-5-2-6-10-16/h1-10,17,19,21,23H,11-12,14H2,(H,24,26) |
| InChIKey | UPEPGDPXYDUUJZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|