C20H18NO5- — CID 7332925
(3R)-3-(1,3-dioxoisoindol-2-yl)-3-(4-propan-2-yloxyphenyl)propanoate (PubChem CID 7332925) has the molecular formula C20H18NO5- and a molecular weight of 352.37 g/mol. Its IUPAC name is (3R)-3-(1,3-dioxoisoindol-2-yl)-3-(4-propan-2-yloxyphenyl)propanoate.
| Compound Name | (3R)-3-(1,3-dioxoisoindol-2-yl)-3-(4-propan-2-yloxyphenyl)propanoate |
|---|---|
| PubChem CID | 7332925 |
| Molecular Formula | C20H18NO5- |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (3R)-3-(1,3-dioxoisoindol-2-yl)-3-(4-propan-2-yloxyphenyl)propanoate |
| SMILES | CC(C)Oc1ccc([C@@H](CC(=O)[O-])N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-12(2)26-14-9-7-13(8-10-14)17(11-18(22)23)21-19(24)15-5-3-4-6-16(15)20(21)25/h3-10,12,17H,11H2,1-2H3,(H,22,23)/p-1/t17-/m1/s1 |
| InChIKey | KJQRYVOOUYQWOG-QGZVFWFLSA-M |
| XLogP | 1.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|