C37H31NO4P+ — CID 23315134
[4-[1-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]phenyl]methyl-triphenylphosphanium (PubChem CID 23315134) has the molecular formula C37H31NO4P+ and a molecular weight of 584.63 g/mol. Its IUPAC name is [4-[1-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-[1-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 23315134 |
| Molecular Formula | C37H31NO4P+ |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | [4-[1-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropyl]phenyl]methyl-triphenylphosphanium |
| SMILES | COC(=O)CC(c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H31NO4P/c1-42-35(39)25-34(38-36(40)32-19-11-12-20-33(32)37(38)41)28-23-21-27(22-24-28)26-43(29-13-5-2-6-14-29,30-15-7-3-8-16-30)31-17-9-4-10-18-31/h2-24,34H,25-26H2,1H3/q+1 |
| InChIKey | RQQSVYCLSLVZFU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|