C26H27NO6 — CID 19690185
methyl 3-[3-(2-bicyclo[2.2.1]heptanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 19690185) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is methyl 3-[3-(2-bicyclo[2.2.1]heptanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | methyl 3-[3-(2-bicyclo[2.2.1]heptanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 19690185 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | methyl 3-[3-(2-bicyclo[2.2.1]heptanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OC)c(OC2CC3CCC2C3)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H27NO6/c1-31-21-10-9-16(13-23(21)33-22-12-15-7-8-17(22)11-15)20(14-24(28)32-2)27-25(29)18-5-3-4-6-19(18)26(27)30/h3-6,9-10,13,15,17,20,22H,7-8,11-12,14H2,1-2H3 |
| InChIKey | UMSYBIIWWSFGHU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|