C26H28N2O5 — CID 19690172
3-[3-(2-bicyclo[2.2.2]octanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19690172) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[3-(2-bicyclo[2.2.2]octanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | 3-[3-(2-bicyclo[2.2.2]octanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19690172 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-[3-(2-bicyclo[2.2.2]octanyloxy)-4-methoxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1ccc(C(CC(N)=O)N2C(=O)c3ccccc3C2=O)cc1OC1CC2CCC1CC2 |
| InChI | InChI=1S/C26H28N2O5/c1-32-21-11-10-17(13-23(21)33-22-12-15-6-8-16(22)9-7-15)20(14-24(27)29)28-25(30)18-4-2-3-5-19(18)26(28)31/h2-5,10-11,13,15-16,20,22H,6-9,12,14H2,1H3,(H2,27,29) |
| InChIKey | WPZNZOKGHXYJDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|