C26H31BrN4O5S — CID 73330286
4-acetyl-N-[3-[(4-bromophenyl)sulfamoyl]-4-[3-(dimethylamino)propoxy]phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 73330286) has the molecular formula C26H31BrN4O5S and a molecular weight of 591.53 g/mol. Its IUPAC name is 4-acetyl-N-[3-[(4-bromophenyl)sulfamoyl]-4-[3-(dimethylamino)propoxy]phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[3-[(4-bromophenyl)sulfamoyl]-4-[3-(dimethylamino)propoxy]phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 73330286 |
| Molecular Formula | C26H31BrN4O5S |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | 4-acetyl-N-[3-[(4-bromophenyl)sulfamoyl]-4-[3-(dimethylamino)propoxy]phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)Nc2ccc(OCCCN(C)C)c(S(=O)(=O)Nc3ccc(Br)cc3)c2)c1C |
| InChI | InChI=1S/C26H31BrN4O5S/c1-16-24(18(3)32)17(2)28-25(16)26(33)29-21-11-12-22(36-14-6-13-31(4)5)23(15-21)37(34,35)30-20-9-7-19(27)8-10-20/h7-12,15,28,30H,6,13-14H2,1-5H3,(H,29,33) |
| InChIKey | GXRPUIRLBQQZJB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|