C15H22O3 — CID 73330297
2,3-bis(methoxymethyl)-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one (PubChem CID 73330297) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,3-bis(methoxymethyl)-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one.
| Compound Name | 2,3-bis(methoxymethyl)-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 73330297 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2,3-bis(methoxymethyl)-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one |
| SMILES | COCC1=C(COC)CC2=C(CCC(=O)CC2)C1 |
| InChI | InChI=1S/C15H22O3/c1-17-9-13-7-11-3-5-15(16)6-4-12(11)8-14(13)10-18-2/h3-10H2,1-2H3 |
| InChIKey | IDTRYWVOLOYBLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|