C27H32N4O4 — CID 73330563
(E)-1-[3-[4-[(2-methylphenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one (PubChem CID 73330563) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is (E)-1-[3-[4-[(2-methylphenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[4-[(2-methylphenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 73330563 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (E)-1-[3-[4-[(2-methylphenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-(2-nitrophenyl)prop-2-en-1-one |
| SMILES | Cc1ccccc1CN1CCN(C(=O)C2CCCN(C(=O)/C=C/c3ccccc3[N+](=O)[O-])C2)CC1 |
| InChI | InChI=1S/C27H32N4O4/c1-21-7-2-3-9-23(21)19-28-15-17-29(18-16-28)27(33)24-10-6-14-30(20-24)26(32)13-12-22-8-4-5-11-25(22)31(34)35/h2-5,7-9,11-13,24H,6,10,14-20H2,1H3/b13-12+ |
| InChIKey | OBYDLOPPCMFXKW-OUKQBFOZSA-N |
| XLogP | 3.50 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|