C34H44ClN7O2 — CID 73330668
4-chloro-N-[1-[1-[(E)-2-cyano-4-methyl-4-(methylamino)pent-2-enoyl]piperidin-3-yl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]benzamide (PubChem CID 73330668) has the molecular formula C34H44ClN7O2 and a molecular weight of 618.23 g/mol. Its IUPAC name is 4-chloro-N-[1-[1-[(E)-2-cyano-4-methyl-4-(methylamino)pent-2-enoyl]piperidin-3-yl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[1-[(E)-2-cyano-4-methyl-4-(methylamino)pent-2-enoyl]piperidin-3-yl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 73330668 |
| Molecular Formula | C34H44ClN7O2 |
| Molecular Weight | 618.23 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 4-chloro-N-[1-[1-[(E)-2-cyano-4-methyl-4-(methylamino)pent-2-enoyl]piperidin-3-yl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]benzamide |
| SMILES | CNC(C)(C)/C=C(\C#N)C(=O)N1CCCC(n2c(NC(=O)c3ccc(Cl)cc3)nc3cc(CN[C@@H](C)C(C)(C)C)ccc32)C1 |
| InChI | InChI=1S/C34H44ClN7O2/c1-22(33(2,3)4)38-20-23-10-15-29-28(17-23)39-32(40-30(43)24-11-13-26(35)14-12-24)42(29)27-9-8-16-41(21-27)31(44)25(19-36)18-34(5,6)37-7/h10-15,17-18,22,27,37-38H,8-9,16,20-21H2,1-7H3,(H,39,40,43)/b25-18+/t22-,27?/m0/s1 |
| InChIKey | YMPXKUVQIXMIJU-ZTNCPJKTSA-N |
| XLogP | 6.08 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.23 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|