C33H42ClN7O2 — CID 123169922
N-[1-[[1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide (PubChem CID 123169922) has the molecular formula C33H42ClN7O2 and a molecular weight of 604.20 g/mol. Its IUPAC name is N-[1-[[1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[[1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 123169922 |
| Molecular Formula | C33H42ClN7O2 |
| Molecular Weight | 604.20 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | N-[1-[[1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide |
| SMILES | C[C@H](NCc1ccc2c(c1)nc(NC(=O)c1ccc(Cl)cc1)n2CC1CCCN1C(=O)C(C#N)=CC(C)(C)N)C(C)(C)C |
| InChI | InChI=1S/C33H42ClN7O2/c1-21(32(2,3)4)37-19-22-9-14-28-27(16-22)38-31(39-29(42)23-10-12-25(34)13-11-23)41(28)20-26-8-7-15-40(26)30(43)24(18-35)17-33(5,6)36/h9-14,16-17,21,26,37H,7-8,15,19-20,36H2,1-6H3,(H,38,39,42)/t21-,26?/m0/s1 |
| InChIKey | VIBYUJSXJRKUAT-GVNKFJBHSA-N |
| XLogP | 5.64 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.20 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|