C33H40F2N6O2 — CID 140682823
N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-3-(difluoromethyl)benzamide (PubChem CID 140682823) has the molecular formula C33H40F2N6O2 and a molecular weight of 590.72 g/mol. Its IUPAC name is N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-3-(difluoromethyl)benzamide.
| Compound Name | N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-3-(difluoromethyl)benzamide |
|---|---|
| PubChem CID | 140682823 |
| Molecular Formula | C33H40F2N6O2 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-3-(difluoromethyl)benzamide |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCCC1Cn1c(NC(=O)c2cccc(C(F)F)c2)nc2cc(CNCC(C)(C)C)ccc21 |
| InChI | InChI=1S/C33H40F2N6O2/c1-21(2)14-25(17-36)31(43)40-13-7-10-26(40)19-41-28-12-11-22(18-37-20-33(3,4)5)15-27(28)38-32(41)39-30(42)24-9-6-8-23(16-24)29(34)35/h6,8-9,11-12,14-16,21,26,29,37H,7,10,13,18-20H2,1-5H3,(H,38,39,42) |
| InChIKey | QKHAFOXBAADVOW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|