C29H37N7O3 — CID 140682800
N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 140682800) has the molecular formula C29H37N7O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 140682800 |
| Molecular Formula | C29H37N7O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | N-[1-[[1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCCC1Cn1c(NC(=O)c2ccno2)nc2cc(CNCC(C)(C)C)ccc21 |
| InChI | InChI=1S/C29H37N7O3/c1-19(2)13-21(15-30)27(38)35-12-6-7-22(35)17-36-24-9-8-20(16-31-18-29(3,4)5)14-23(24)33-28(36)34-26(37)25-10-11-32-39-25/h8-11,13-14,19,22,31H,6-7,12,16-18H2,1-5H3,(H,33,34,37) |
| InChIKey | ZPMXHBLIXDCJKL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|