C24H15ClF3N7O — CID 73330892
4-chloro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 73330892) has the molecular formula C24H15ClF3N7O and a molecular weight of 509.88 g/mol. Its IUPAC name is 4-chloro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 73330892 |
| Molecular Formula | C24H15ClF3N7O |
| Molecular Weight | 509.88 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 4-chloro-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(Cl)c(Nc2ncccc2-c2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C24H15ClF3N7O/c25-17-7-6-13(23(36)34-15-4-1-3-14(10-15)24(26,27)28)9-18(17)35-21-16(5-2-8-29-21)19-20-22(32-11-30-19)33-12-31-20/h1-12H,(H,29,35)(H,34,36)(H,30,31,32,33) |
| InChIKey | KEWAGIYMGOBSQD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |