C15H19NO4 — CID 73333119
methyl 2-[4-[2-hydroxy-3-(prop-2-ynylamino)propoxy]phenyl]acetate (PubChem CID 73333119) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 2-[4-[2-hydroxy-3-(prop-2-ynylamino)propoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-hydroxy-3-(prop-2-ynylamino)propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 73333119 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 2-[4-[2-hydroxy-3-(prop-2-ynylamino)propoxy]phenyl]acetate |
| SMILES | C#CCNCC(O)COc1ccc(CC(=O)OC)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-3-8-16-10-13(17)11-20-14-6-4-12(5-7-14)9-15(18)19-2/h1,4-7,13,16-17H,8-11H2,2H3 |
| InChIKey | QAHAFOCJBMVFOI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|