C20H25NO4 — CID 67575856
methyl 2-[4-[(2S)-3-amino-4-hydroxy-2-methyl-4-phenylbutoxy]phenyl]acetate (PubChem CID 67575856) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is methyl 2-[4-[(2S)-3-amino-4-hydroxy-2-methyl-4-phenylbutoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[(2S)-3-amino-4-hydroxy-2-methyl-4-phenylbutoxy]phenyl]acetate |
|---|---|
| PubChem CID | 67575856 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl 2-[4-[(2S)-3-amino-4-hydroxy-2-methyl-4-phenylbutoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OC[C@@H](C)C(N)C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-14(19(21)20(23)16-6-4-3-5-7-16)13-25-17-10-8-15(9-11-17)12-18(22)24-2/h3-11,14,19-20,23H,12-13,21H2,1-2H3/t14-,19?,20?/m1/s1 |
| InChIKey | CSHZNAMRBNQXQU-WPUWVODUSA-N |
| XLogP | 2.48 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |