C21H27NO4 — CID 151884472
methyl 2-[4-[(3R,4S)-4-amino-4-hydroxy-2,3-dimethyl-4-phenylbutoxy]phenyl]acetate (PubChem CID 151884472) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 2-[4-[(3R,4S)-4-amino-4-hydroxy-2,3-dimethyl-4-phenylbutoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[(3R,4S)-4-amino-4-hydroxy-2,3-dimethyl-4-phenylbutoxy]phenyl]acetate |
|---|---|
| PubChem CID | 151884472 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | methyl 2-[4-[(3R,4S)-4-amino-4-hydroxy-2,3-dimethyl-4-phenylbutoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCC(C)[C@@H](C)[C@](N)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-15(16(2)21(22,24)18-7-5-4-6-8-18)14-26-19-11-9-17(10-12-19)13-20(23)25-3/h4-12,15-16,24H,13-14,22H2,1-3H3/t15?,16-,21+/m1/s1 |
| InChIKey | SPKKJZQSBFHMNQ-BRTDBVSSSA-N |
| XLogP | 2.86 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|