C20H24ClNO4 — CID 23185518
methyl 2-[4-[2-[[1-(3-chlorophenyl)-1-hydroxyethyl]amino]propoxy]phenyl]acetate (PubChem CID 23185518) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is methyl 2-[4-[2-[[1-(3-chlorophenyl)-1-hydroxyethyl]amino]propoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-[[1-(3-chlorophenyl)-1-hydroxyethyl]amino]propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 23185518 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl 2-[4-[2-[[1-(3-chlorophenyl)-1-hydroxyethyl]amino]propoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCC(C)NC(C)(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c1-14(22-20(2,24)16-5-4-6-17(21)12-16)13-26-18-9-7-15(8-10-18)11-19(23)25-3/h4-10,12,14,22,24H,11,13H2,1-3H3 |
| InChIKey | FQIDYHKFZKQAKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|