methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate

C11H14O4 — CID 73334384

IUPACmethyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate
SMILESCOC(=O)/C=C/CC1(C)C(=O)CCC1=O
InChIInChI=1S/C11H14O4/c1-11(7-3-4-10(14)15-2)8(12)5-6-9(11)13/h3-4H,5-7H2,1-2H3/b4-3+
InChIKeyBBCXKXFTDGLADQ-ONEGZZNKSA-N
MW210.23 g/mol
LogP1.04
Rot. Bonds3

About methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate

methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate (PubChem CID 73334384) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate.

Molecular Properties

Compound Namemethyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate
PubChem CID73334384
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Namemethyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate
SMILESCOC(=O)/C=C/CC1(C)C(=O)CCC1=O
InChIInChI=1S/C11H14O4/c1-11(7-3-4-10(14)15-2)8(12)5-6-9(11)13/h3-4H,5-7H2,1-2H3/b4-3+
InChIKeyBBCXKXFTDGLADQ-ONEGZZNKSA-N
XLogP1.04
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate?
The IUPAC name of methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate (CID 73334384) is methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate.
What is the SMILES notation for methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate?
The canonical SMILES for methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate is COC(=O)/C=C/CC1(C)C(=O)CCC1=O.
What is the InChIKey of methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate?
The InChIKey is BBCXKXFTDGLADQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H14O4/c1-11(7-3-4-10(14)15-2)8(12)5-6-9(11)13/h3-4H,5-7H2,1-2H3/b4-3+.
What are the key properties of methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate?
methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate has a molecular weight of 210.23 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate is sourced from PubChem (CID 73334384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).