C11H14O4 — CID 73334384
methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate (PubChem CID 73334384) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate.
| Compound Name | methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate |
|---|---|
| PubChem CID | 73334384 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | methyl (E)-4-(1-methyl-2,5-dioxocyclopentyl)but-2-enoate |
| SMILES | COC(=O)/C=C/CC1(C)C(=O)CCC1=O |
| InChI | InChI=1S/C11H14O4/c1-11(7-3-4-10(14)15-2)8(12)5-6-9(11)13/h3-4H,5-7H2,1-2H3/b4-3+ |
| InChIKey | BBCXKXFTDGLADQ-ONEGZZNKSA-N |
| XLogP | 1.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|