About methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate
methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate (PubChem CID 85366182) has the molecular formula C12H15BrO4
and a molecular weight of 303.15 g/mol. Its IUPAC name is methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate.
Molecular Properties
| Compound Name | methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate |
| PubChem CID | 85366182 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate |
| SMILES | COC(=O)C(Br)=CCCC1(C)C(=O)CCC1=O |
| InChI | InChI=1S/C12H15BrO4/c1-12(9(14)5-6-10(12)15)7-3-4-8(13)11(16)17-2/h4H,3,5-7H2,1-2H3 |
| InChIKey | JDKYBXRWPRILQA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate?
The IUPAC name of methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate (CID 85366182) is methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate.
What is the SMILES notation for methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate?
The canonical SMILES for methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate is COC(=O)C(Br)=CCCC1(C)C(=O)CCC1=O.
What is the InChIKey of methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate?
The InChIKey is JDKYBXRWPRILQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO4/c1-12(9(14)5-6-10(12)15)7-3-4-8(13)11(16)17-2/h4H,3,5-7H2,1-2H3.
What are the key properties of methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate?
methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate has a molecular weight of 303.15 g/mol, XLogP of 2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5-(1-methyl-2,5-dioxocyclopentyl)pent-2-enoate is sourced from PubChem (CID 85366182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).