C19H16FNO5 — CID 73334702
ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate (PubChem CID 73334702) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate.
| Compound Name | ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 73334702 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)/C=C/c1cc(C(=O)c2ccc(F)cc2)c[nH]1 |
| InChI | InChI=1S/C19H16FNO5/c1-2-26-19(25)17(23)10-16(22)8-7-15-9-13(11-21-15)18(24)12-3-5-14(20)6-4-12/h3-11,21,23H,2H2,1H3/b8-7+,17-10- |
| InChIKey | BKRBFQGZRFHEBJ-GTRPGCKKSA-N |
| XLogP | 2.97 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|