C22H15NOS — CID 73334913
3-(4-thiophen-3-yl-5H-indeno[1,2-b]pyridin-2-yl)phenol (PubChem CID 73334913) has the molecular formula C22H15NOS and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-(4-thiophen-3-yl-5H-indeno[1,2-b]pyridin-2-yl)phenol.
| Compound Name | 3-(4-thiophen-3-yl-5H-indeno[1,2-b]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 73334913 |
| Molecular Formula | C22H15NOS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 3-(4-thiophen-3-yl-5H-indeno[1,2-b]pyridin-2-yl)phenol |
| SMILES | Oc1cccc(-c2cc(-c3ccsc3)c3c(n2)-c2ccccc2C3)c1 |
| InChI | InChI=1S/C22H15NOS/c24-17-6-3-5-15(10-17)21-12-19(16-8-9-25-13-16)20-11-14-4-1-2-7-18(14)22(20)23-21/h1-10,12-13,24H,11H2 |
| InChIKey | SQIHXMJEWHKVEK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |