C27H22N4O5 — CID 73336088
methyl 4-[(3E)-1-[2-(benzimidazol-1-yl)ethyl]-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 73336088) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is methyl 4-[(3E)-1-[2-(benzimidazol-1-yl)ethyl]-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-1-[2-(benzimidazol-1-yl)ethyl]-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 73336088 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 4-[(3E)-1-[2-(benzimidazol-1-yl)ethyl]-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2CCn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C27H22N4O5/c1-36-27(35)19-8-6-17(7-9-19)23-22(24(32)18-10-12-28-13-11-18)25(33)26(34)31(23)15-14-30-16-29-20-4-2-3-5-21(20)30/h2-13,16,23,32H,14-15H2,1H3/b24-22+ |
| InChIKey | ZPMYGNJFQRHMAU-ZNTNEXAZSA-N |
| XLogP | 3.34 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|